2,2'-DICHLOROBENZIL
Catalog No: FT-0609210
CAS No: 21854-95-5
- Molecular Formula: 279.1
- Formula Weight: C14H8Cl2O2
- Inchl Key: VOSNNSVWVJFJCR-UHFFFAOYSA-N
- Inchl: InChI=1S/C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 426.9ºC at 760 mmHg |
|---|---|
| CAS: | 21854-95-5 |
| MF: | C14H8Cl2O2 |
| Melting_Point: | 132-136ºC(lit.) |
| Symbol: | Warning |
| Density: | 1.366g/cm3 |
| FW: | 279.11800 |
| Product_Name: | 1,2-bis(2-chlorophenyl)ethane-1,2-dione |
| Flash_Point: | 180.2ºC |
| Bolling_Point: | 426.9ºC at 760 mmHg |
|---|---|
| Vapor_Pressure: | 1.71E-07mmHg at 25°C |
| LogP: | 4.05900 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）Unknow ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）132-136 ', '5. Boiling point（ºC,Atmospheric pressure）Unknow ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive indexUnknow ', '8. Flash point（ºC）Unknow ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Computational_Chemistry: | ['1. XlogP :42 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :3 ', '5. Isotope Atom Count :N/A ', '6. TPSA 341 ', '7. Heavy Atom Count :18 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :298 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 132-136ºC(lit.) |
| Exact_Mass: | 277.99000 |
| MF: | C14H8Cl2O2 |
| Density: | 1.366g/cm3 |
| Refractive_Index: | 1.612 |
| PSA: | 34.14000 |
| Flash_Point: | 180.2ºC |
| Molecular_Structure: | ['1 . Molar refractive index 7103 ', '2 . Molar volume (m3/mol)2042 ', '3 . Parachor (902K)5449 ', '4 表面张力(dyne/cm)506 ', '5 . Polarizability (10-24cm3)2816'] |
| FW: | 279.11800 |
| Symbol: | Warning |
|---|---|
| HS_Code: | 2914700090 |
| Safety_Statements: | S22-S24/25 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Warning_Statement: | P273-P305 + P351 + P338 |
| RIDADR: | UN 3077 9/PG 3 |
| Risk_Statements(EU): | 36-50/53 |
| Hazard_Codes: | Xi: Irritant;N: Dangerous for the environment; |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
