1-(4-CHLOROPHENYL)BIGUANIDE HYDROCHLORIDE
Catalog No: FT-0605698
CAS No: 4022-81-5
- Molecular Formula: 248.11
- Formula Weight: C8H11Cl2N5
- Inchl Key: NAFSLMFLGYXGIF-UHFFFAOYSA-N
- Inchl: InChI=1S/C8H10ClN5.ClH/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 248.11200 |
| Density: | N/A |
| CAS: | 4022-81-5 |
| Bolling_Point: | 426.4ºC at 760 mmHg |
| Product_Name: | 1-(4-chlorophenyl)biguanide hydrochloride |
| Melting_Point: | 239-242 °C(lit.) |
| Flash_Point: | 211.7ºC |
| MF: | C8H11Cl2N5 |
| LogP: | 3.33540 |
|---|---|
| Flash_Point: | 211.7ºC |
| Melting_Point: | 239-242 °C(lit.) |
| FW: | 248.11200 |
| PSA: | 97.78000 |
| MF: | C8H11Cl2N5 |
| Bolling_Point: | 426.4ºC at 760 mmHg |
| Vapor_Pressure: | 1.78E-07mmHg at 25°C |
| Exact_Mass: | 247.03900 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| RTECS: | DU1780200 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| WGK_Germany: | 3 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)